CAS 216016-31-8 is the registry number for 2-Amino-3-methyl-6-(trifluoromethyl)-3,4-dihydropyrimidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-amino-3-methyl-6-(trifluoromethyl)pyrimidin-4-one (CAS 216016-31-8) is a chemical compound with the molecular formula C6H6F3N3O and a molecular weight of 193.13 g/mol. IUPAC name: 2-amino-3-methyl-6-(trifluoromethyl)pyrimidin-4-one. InChIKey: HILJAKYDYCKBTC-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3O |
|---|---|
| Molecular weight | 193.13 g/mol |
| IUPAC name | 2-amino-3-methyl-6-(trifluoromethyl)pyrimidin-4-one |
| InChIKey | HILJAKYDYCKBTC-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=C(N=C1N)C(F)(F)F |
Computed by PubChem (NCBI)