Products 1246184-50-8
CAS 1246184-50-8 is the registry number for 6-Bromo-3-iodo-2-methylimidazo[1,2-a]pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-bromo-3-iodo-2-methylimidazo[1,2-a]pyridine (CAS 1246184-50-8) is a chemical compound with the molecular formula C8H6BrIN2 and a molecular weight of 336.95 g/mol. IUPAC name: 6-bromo-3-iodo-2-methylimidazo[1,2-a]pyridine. InChIKey: WJCDXGZHNALQMI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIN2 |
|---|---|
| Molecular weight | 336.95 g/mol |
| IUPAC name | 6-bromo-3-iodo-2-methylimidazo[1,2-a]pyridine |
| InChIKey | WJCDXGZHNALQMI-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=C(C=CC2=N1)Br)I |
Computed by PubChem (NCBI)