Products 1246213-41-1
CAS 1246213-41-1 is the registry number for Ivacaftor Carboxylic Acid Lactone. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
N-(5-tert-butyl-3,3-dimethyl-2-oxo-1-benzofuran-6-yl)-4-oxo-1H-quinoline-3-carboxamide (CAS 1246213-41-1) is a chemical compound with the molecular formula C24H24N2O4 and a molecular weight of 404.5 g/mol. IUPAC name: N-(5-tert-butyl-3,3-dimethyl-2-oxo-1-benzofuran-6-yl)-4-oxo-1H-quinoline-3-carboxamide. InChIKey: WVXNTZZDMNDZHM-UHFFFAOYSA-N.
| Molecular formula | C24H24N2O4 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | N-(5-tert-butyl-3,3-dimethyl-2-oxo-1-benzofuran-6-yl)-4-oxo-1H-quinoline-3-carboxamide |
| InChIKey | WVXNTZZDMNDZHM-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC(=C(C=C2OC1=O)NC(=O)C3=CNC4=CC=CC=C4C3=O)C(C)(C)C)C |
Computed by PubChem (NCBI)