CAS 2375193-74-9 appears in our catalog under these names: DBCO-NH-(CH2)4COOH, 98%, DBCO–NH–(CH2)4COOH, DBCO-NH-(CH2)4COOH 99%, DBCO-NH-(CH2)4COOH, 98%, 98%, DBCO-NH-(CH2)4COOH, 98.15%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, 5 mg, 25 mg, 10 mg, 50 mg, 100 mg.
6-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-6-oxohexanoic acid (CAS 2375193-74-9) is a chemical compound with the molecular formula C24H24N2O4 and a molecular weight of 404.5 g/mol. IUPAC name: 6-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-6-oxohexanoic acid. InChIKey: WHJBJOBCKOQKTD-UHFFFAOYSA-N.
| Molecular formula | C24H24N2O4 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | 6-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-6-oxohexanoic acid |
| InChIKey | WHJBJOBCKOQKTD-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCNC(=O)CCCCC(=O)O |
Computed by PubChem (NCBI)