CAS 1246215-97-3 appears in our catalog under these names: Metazachlor Metabolite M09, Metazachlor-sulfinyl-acetic acid BH 479-9, Metazachlor Metabolite M09, Concentration: 100 µg/ml Solvent: Ethyl acetate. Offered by: Chemat Brand, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 10mg, 1x1ml.
2-[2-[2,6-dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxoethyl]sulfinylacetic acid (CAS 1246215-97-3) is a chemical compound with the molecular formula C16H19N3O4S and a molecular weight of 349.4 g/mol. IUPAC name: 2-[2-[2,6-dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxoethyl]sulfinylacetic acid. InChIKey: DYCHUHSHQIYFAI-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O4S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 2-[2-[2,6-dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxoethyl]sulfinylacetic acid |
| InChIKey | DYCHUHSHQIYFAI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N(CN2C=CC=N2)C(=O)CS(=O)CC(=O)O |
Computed by PubChem (NCBI)