Products 2636079-21-3
CAS 2636079-21-3 is the registry number for Relugolix Impurity 72. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-amino-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylate (CAS 2636079-21-3) is a chemical compound with the molecular formula C16H19N3O4S and a molecular weight of 349.4 g/mol. IUPAC name: ethyl 2-amino-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylate. InChIKey: BSHOWTDYYZTAKV-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O4S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | ethyl 2-amino-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylate |
| InChIKey | BSHOWTDYYZTAKV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1CN(C)C)C2=CC=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)