Products 1246274-70-3
CAS 1246274-70-3 appears in our catalog under these names: (2-Carboxyethyl)dimethyl-d6-sulfonium Chloride, (2-Carboxyethyl)dimethyl-d6-sulfonium Chloride, 99 atom % D, min 98% Chemical Purity, Dimethylpropiothetin hydrochloride–d6, Dimethylpropiothetin hydrochloride-d6, 99.70%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 5mg, 0,25g, 0,1g, 10 mg, 5 mg.
2-carboxyethyl-bis(trideuteriomethyl)sulfanium chloride (CAS 1246274-70-3) is a chemical compound with the molecular formula C5H11ClO2S and a molecular weight of 176.70 g/mol. IUPAC name: 2-carboxyethyl-bis(trideuteriomethyl)sulfanium chloride. InChIKey: RRUMKKGRKSSZKY-TXHXQZCNSA-N.
| Molecular formula | C5H11ClO2S |
|---|---|
| Molecular weight | 176.70 g/mol |
| IUPAC name | 2-carboxyethyl-bis(trideuteriomethyl)sulfanium chloride |
| InChIKey | RRUMKKGRKSSZKY-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])[S+](CCC(=O)O)C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)