Products 78429-87-5

CAS 78429-87-5 is the registry number for 3-Methylbutane-2-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-methylbutane-2-sulfonyl chloride (CAS 78429-87-5) is a chemical compound with the molecular formula C5H11ClO2S and a molecular weight of 170.66 g/mol. IUPAC name: 3-methylbutane-2-sulfonyl chloride. InChIKey: VLNMHTQPLCZFKY-UHFFFAOYSA-N.

Identity
Molecular formulaC5H11ClO2S
Molecular weight170.66 g/mol
IUPAC name3-methylbutane-2-sulfonyl chloride
InChIKeyVLNMHTQPLCZFKY-UHFFFAOYSA-N
SMILESCC(C)C(C)S(=O)(=O)Cl

Computed by PubChem (NCBI)