CAS 1246355-68-9 appears in our catalog under these names: D-myo-Inositol, 1,3,4,5-tetrakis(dihydrogen phosphate), ammonium salt (1:4), 98%, D-Myo-inositol-1,3,4,5-tetraphosphate, IP4(1 3 4 5), Inositol 1,3,4,5-tetraphosphate (tetraammonium). Offered by: Chemat Brand, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 1mg, 100UG, 500UG, Get quote.
Azane;[(1R,2S,4S,5S)-2,4-dihydroxy-3,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate (CAS 1246355-68-9) is a chemical compound with the molecular formula C6H19NO18P4 and a molecular weight of 517.11 g/mol. IUPAC name: azane;[(1R,2S,4S,5S)-2,4-dihydroxy-3,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate. InChIKey: LDRGGXGJARVUBP-HQMYMHGMSA-N.
| Molecular formula | C6H19NO18P4 |
|---|---|
| Molecular weight | 517.11 g/mol |
| IUPAC name | azane;[(1R,2S,4S,5S)-2,4-dihydroxy-3,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate |
| InChIKey | LDRGGXGJARVUBP-HQMYMHGMSA-N |
| SMILES | [C@H]1([C@H](C([C@H]([C@H](C1OP(=O)(O)O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)O.N |
Computed by PubChem (NCBI)