CAS 91796-88-2 is the registry number for Inositol 1,2,5,6-tetrakis(phosphate), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Azane;[(1S,2R,3R,4R,5R,6R)-2,3-dihydroxy-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate (CAS 91796-88-2) is a chemical compound with the molecular formula C6H19NO18P4 and a molecular weight of 517.11 g/mol. IUPAC name: azane;[(1S,2R,3R,4R,5R,6R)-2,3-dihydroxy-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate. InChIKey: MPALWCVIGLCHDH-TYZYTZLSSA-N.
| Molecular formula | C6H19NO18P4 |
|---|---|
| Molecular weight | 517.11 g/mol |
| IUPAC name | azane;[(1S,2R,3R,4R,5R,6R)-2,3-dihydroxy-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate |
| InChIKey | MPALWCVIGLCHDH-TYZYTZLSSA-N |
| SMILES | [C@H]1([C@H]([C@@H]([C@H]([C@@H]([C@@H]1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)O)O.N |
Computed by PubChem (NCBI)