CAS 1246471-30-6 appears in our catalog under these names: 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone, 95%, 2–Bromo–1–(2–bromo–4,6–dimethylphenyl)ethanone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
2-bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone (CAS 1246471-30-6) is a chemical compound with the molecular formula C10H10Br2O and a molecular weight of 305.99 g/mol. IUPAC name: 2-bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone. InChIKey: XZTGWLXJXCOBJM-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O |
|---|---|
| Molecular weight | 305.99 g/mol |
| IUPAC name | 2-bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone |
| InChIKey | XZTGWLXJXCOBJM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)C(=O)CBr)C |
Computed by PubChem (NCBI)