Products 2089398-57-0
CAS 2089398-57-0 is the registry number for 5,7-Dibromo-1,2,3,4-tetrahydronaphthalen-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dibromo-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 2089398-57-0) is a chemical compound with the molecular formula C10H10Br2O and a molecular weight of 305.99 g/mol. IUPAC name: 5,7-dibromo-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: ZGJICDSBTPYKMZ-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O |
|---|---|
| Molecular weight | 305.99 g/mol |
| IUPAC name | 5,7-dibromo-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | ZGJICDSBTPYKMZ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC(=C2)Br)Br)O |
Computed by PubChem (NCBI)