Products 1246552-73-7
CAS 1246552-73-7 is the registry number for 3-Bromo-6-methoxypyrazolo[1,5-b]pyridazine, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
3-bromo-6-methoxypyrazolo[1,5-b]pyridazine (CAS 1246552-73-7) is a chemical compound with the molecular formula C7H6BrN3O and a molecular weight of 228.05 g/mol. IUPAC name: 3-bromo-6-methoxypyrazolo[1,5-b]pyridazine. InChIKey: IQYHNHRYFCMGSI-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3O |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | 3-bromo-6-methoxypyrazolo[1,5-b]pyridazine |
| InChIKey | IQYHNHRYFCMGSI-UHFFFAOYSA-N |
| SMILES | COC1=NN2C(=C(C=N2)Br)C=C1 |
Computed by PubChem (NCBI)