Products 1246632-86-9
CAS 1246632-86-9 is the registry number for 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1246632-86-9) is a chemical compound with the molecular formula C13H15BClNO2 and a molecular weight of 263.53 g/mol. IUPAC name: 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: AVIJAORVKMOKBX-UHFFFAOYSA-N.
| Molecular formula | C13H15BClNO2 |
|---|---|
| Molecular weight | 263.53 g/mol |
| IUPAC name | 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | AVIJAORVKMOKBX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)C#N |
Computed by PubChem (NCBI)