Products 1246814-68-5
CAS 1246814-68-5 is the registry number for 6-Amino-5-nitroso-2-thiouracil-13C,15N. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
6-amino-5-(15N)nitroso-2-sulfanylidene-(613C)1H-pyrimidin-4-one (CAS 1246814-68-5) is a chemical compound with the molecular formula C4H4N4O2S and a molecular weight of 174.15 g/mol. IUPAC name: 6-amino-5-(15N)nitroso-2-sulfanylidene-(613C)1H-pyrimidin-4-one. InChIKey: UOWCFGBLAMCSFY-RETHMIJMSA-N.
| Molecular formula | C4H4N4O2S |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | 6-amino-5-(15N)nitroso-2-sulfanylidene-(613C)1H-pyrimidin-4-one |
| InChIKey | UOWCFGBLAMCSFY-RETHMIJMSA-N |
| SMILES | C1(=[13C](NC(=S)NC1=O)N)[15N]=O |
Computed by PubChem (NCBI)