CAS 6266-15-5 appears in our catalog under these names: 4-Amino-5-nitropyrimidine-2-thiol, 4-Amino-5-nitropyrimidine-2-thiol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
6-amino-5-nitro-1H-pyrimidine-2-thione (CAS 6266-15-5) is a chemical compound with the molecular formula C4H4N4O2S and a molecular weight of 172.17 g/mol. IUPAC name: 6-amino-5-nitro-1H-pyrimidine-2-thione. InChIKey: ZUBDTVFGNPAKFJ-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O2S |
|---|---|
| Molecular weight | 172.17 g/mol |
| IUPAC name | 6-amino-5-nitro-1H-pyrimidine-2-thione |
| InChIKey | ZUBDTVFGNPAKFJ-UHFFFAOYSA-N |
| SMILES | C1=NC(=S)NC(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)