CAS 1246814-72-1 appears in our catalog under these names: O-(4-((tert-Butoxycarbonyl)oxy)benzyl) methanesulfonothioate, 98%, 4-(tert-Butoxycarbonyloxy)benzyl Methanethiosulfonate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
Tert-butyl [4-(methylsulfonylsulfanylmethyl)phenyl] carbonate (CAS 1246814-72-1) is a chemical compound with the molecular formula C13H18O5S2 and a molecular weight of 318.4 g/mol. IUPAC name: tert-butyl [4-(methylsulfonylsulfanylmethyl)phenyl] carbonate. InChIKey: VVQRYFCAUUYJKC-UHFFFAOYSA-N.
| Molecular formula | C13H18O5S2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | tert-butyl [4-(methylsulfonylsulfanylmethyl)phenyl] carbonate |
| InChIKey | VVQRYFCAUUYJKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=CC=C(C=C1)CSS(=O)(=O)C |
Computed by PubChem (NCBI)