CAS 928149-12-6 appears in our catalog under these names: (1,1-Dioxidotetrahydrothiopyran-4-yl)methyl 4-methylbenzenesulfonate, 95%, (1,1–Dioxidotetrahydrothiopyran–4–yl)methyl 4–Methylbenzenesulfonate, (1,1-Dioxidotetrahydrothiopyran-4-yl)methyl 4-Methylbenzenesulfonate, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g.
(1,1-dioxothian-4-yl)methyl 4-methylbenzenesulfonate (CAS 928149-12-6) is a chemical compound with the molecular formula C13H18O5S2 and a molecular weight of 318.4 g/mol. IUPAC name: (1,1-dioxothian-4-yl)methyl 4-methylbenzenesulfonate. InChIKey: GXGVEFJXZNTKAU-UHFFFAOYSA-N.
| Molecular formula | C13H18O5S2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (1,1-dioxothian-4-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | GXGVEFJXZNTKAU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2CCS(=O)(=O)CC2 |
Computed by PubChem (NCBI)