CAS 1246815-04-2 appears in our catalog under these names: (R)-Viloxazine-d5 Hydrochloride, >95% (HPLC), (R)-Viloxazine-d5 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
(2R)-2-[[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]methyl]morpholine;hydrochloride (CAS 1246815-04-2) is a chemical compound with the molecular formula C13H20ClNO3 and a molecular weight of 278.78 g/mol. IUPAC name: (2R)-2-[[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]methyl]morpholine;hydrochloride. InChIKey: HJOCKFVCMLCPTP-WKLLMZCCSA-N.
| Molecular formula | C13H20ClNO3 |
|---|---|
| Molecular weight | 278.78 g/mol |
| IUPAC name | (2R)-2-[[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]methyl]morpholine;hydrochloride |
| InChIKey | HJOCKFVCMLCPTP-WKLLMZCCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC=CC=C1OC[C@H]2CNCCO2.Cl |
Computed by PubChem (NCBI)