Products 1177359-29-3

CAS 1177359-29-3 is the registry number for Methyl 5-[(cyclohexylamino)methyl]-2-furoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-[(cyclohexylamino)methyl]furan-2-carboxylate;hydrochloride (CAS 1177359-29-3) is a chemical compound with the molecular formula C13H20ClNO3 and a molecular weight of 273.75 g/mol. IUPAC name: methyl 5-[(cyclohexylamino)methyl]furan-2-carboxylate;hydrochloride. InChIKey: WWZVEPBLOUHQIN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20ClNO3
Molecular weight273.75 g/mol
IUPAC namemethyl 5-[(cyclohexylamino)methyl]furan-2-carboxylate;hydrochloride
InChIKeyWWZVEPBLOUHQIN-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(O1)CNC2CCCCC2.Cl

Computed by PubChem (NCBI)