Products 1246815-46-2
CAS 1246815-46-2 is the registry number for N-Nitroso-N-methyl-3-aminopropionic Acid-d3, Methyl Ester. Offered by: TRC. Available pack sizes: 50mg.
Methyl 3-[nitroso(trideuteriomethyl)amino]propanoate (CAS 1246815-46-2) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 149.16 g/mol. IUPAC name: methyl 3-[nitroso(trideuteriomethyl)amino]propanoate. InChIKey: NXZQLRDBZJJVLU-FIBGUPNXSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 149.16 g/mol |
| IUPAC name | methyl 3-[nitroso(trideuteriomethyl)amino]propanoate |
| InChIKey | NXZQLRDBZJJVLU-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC(=O)OC)N=O |
Computed by PubChem (NCBI)