Products 204451-48-9
CAS 204451-48-9 appears in our catalog under these names: L-Glutamine-15n2, 95%, L-Glutamine-15N2, >95% (HPLC), L-Glutamine-15N2, 98% 99atom%15N, L–Glutamine–15N2, L-Glutamine-15N2. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 2,5mg, 25mg, 5mg, 500g, 10mg, 100mg, 5 mg.
(2S)-2,5-bis(15N)(azanyl)-5-oxopentanoic acid (CAS 204451-48-9) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 148.13 g/mol. IUPAC name: (2S)-2,5-bis(15N)(azanyl)-5-oxopentanoic acid. InChIKey: ZDXPYRJPNDTMRX-QLUYOLLXSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 148.13 g/mol |
| IUPAC name | (2S)-2,5-bis(15N)(azanyl)-5-oxopentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-QLUYOLLXSA-N |
| SMILES | C(CC(=O)[15NH2])[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)