Products 1246815-89-3

CAS 1246815-89-3 is the registry number for Etifoxine-d3. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 1mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

6-chloro-N-ethyl-4-phenyl-4-(trideuteriomethyl)-1H-3,1-benzoxazin-2-imine (CAS 1246815-89-3) is a chemical compound with the molecular formula C17H17ClN2O and a molecular weight of 303.8 g/mol. IUPAC name: 6-chloro-N-ethyl-4-phenyl-4-(trideuteriomethyl)-1H-3,1-benzoxazin-2-imine. InChIKey: IBYCYJFUEJQSMK-BMSJAHLVSA-N.

Identity
Molecular formulaC17H17ClN2O
Molecular weight303.8 g/mol
IUPAC name6-chloro-N-ethyl-4-phenyl-4-(trideuteriomethyl)-1H-3,1-benzoxazin-2-imine
InChIKeyIBYCYJFUEJQSMK-BMSJAHLVSA-N
SMILES[2H]C([2H])([2H])C1(C2=C(C=CC(=C2)Cl)NC(=NCC)O1)C3=CC=CC=C3

Computed by PubChem (NCBI)

Synonyms: Etifoxine-d3