CAS 1346598-10-4 is the registry number for Etifoxine-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1 mg.
6-chloro-N-ethyl-4-methyl-4-(2,3,4,5,6-pentadeuteriophenyl)-1H-3,1-benzoxazin-2-imine (CAS 1346598-10-4) is a chemical compound with the molecular formula C17H17ClN2O and a molecular weight of 305.8 g/mol. IUPAC name: 6-chloro-N-ethyl-4-methyl-4-(2,3,4,5,6-pentadeuteriophenyl)-1H-3,1-benzoxazin-2-imine. InChIKey: IBYCYJFUEJQSMK-UPKDRLQUSA-N.
| Molecular formula | C17H17ClN2O |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | 6-chloro-N-ethyl-4-methyl-4-(2,3,4,5,6-pentadeuteriophenyl)-1H-3,1-benzoxazin-2-imine |
| InChIKey | IBYCYJFUEJQSMK-UPKDRLQUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(C3=C(C=CC(=C3)Cl)NC(=NCC)O2)C)[2H])[2H] |
Computed by PubChem (NCBI)