CAS 1246816-10-3 is the registry number for Meclizine-d8 N’-oxide. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
4-[(4-chlorophenyl)-phenylmethyl]-1-[(3-methylphenyl)methyl]-1-oxidopiperazin-1-ium (CAS 1246816-10-3) is a chemical compound with the molecular formula C25H27ClN2O and a molecular weight of 406.9 g/mol. IUPAC name: 4-[(4-chlorophenyl)-phenylmethyl]-1-[(3-methylphenyl)methyl]-1-oxidopiperazin-1-ium. InChIKey: NDTIJUDMDNMOFC-UHFFFAOYSA-N.
| Molecular formula | C25H27ClN2O |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)-phenylmethyl]-1-[(3-methylphenyl)methyl]-1-oxidopiperazin-1-ium |
| InChIKey | NDTIJUDMDNMOFC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C[N+]2(CCN(CC2)C(C3=CC=CC=C3)C4=CC=C(C=C4)Cl)[O-] |
Computed by PubChem (NCBI)