CAS 114624-69-0 appears in our catalog under these names: 4-((4-Chlorophenyl)(phenyl)methyl)-1-(3-methylbenzyl)piperazine 1-oxide, 98%, Meclozine Impurity 10, Meclizine N1-Oxide , Meclizine N’-Oxide, Meclozine N-Oxide. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 5mg, 10mg, 1mg, 50 mg, 25 mg.
4-[(4-chlorophenyl)-phenylmethyl]-1-[(3-methylphenyl)methyl]-1-oxidopiperazin-1-ium (CAS 114624-69-0) is a chemical compound with the molecular formula C25H27ClN2O and a molecular weight of 406.9 g/mol. IUPAC name: 4-[(4-chlorophenyl)-phenylmethyl]-1-[(3-methylphenyl)methyl]-1-oxidopiperazin-1-ium. InChIKey: NDTIJUDMDNMOFC-UHFFFAOYSA-N.
| Molecular formula | C25H27ClN2O |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)-phenylmethyl]-1-[(3-methylphenyl)methyl]-1-oxidopiperazin-1-ium |
| InChIKey | NDTIJUDMDNMOFC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C[N+]2(CCN(CC2)C(C3=CC=CC=C3)C4=CC=C(C=C4)Cl)[O-] |
Computed by PubChem (NCBI)