CAS 1246816-14-7 appears in our catalog under these names: Melamine-13C3,15N3, Melamine-13C3,15N3, >95% (HPLC), Melamine-15N3,13C3, 96.08%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
(2,4,6-13C3)1,3,5-triazine-2,4,6-tri(15N3)amine (CAS 1246816-14-7) is a chemical compound with the molecular formula C3H6N6 and a molecular weight of 132.079 g/mol. IUPAC name: (2,4,6-13C3)1,3,5-triazine-2,4,6-tri(15N3)amine. InChIKey: JDSHMPZPIAZGSV-IDEBNGHGSA-N.
| Molecular formula | C3H6N6 |
|---|---|
| Molecular weight | 132.079 g/mol |
| IUPAC name | (2,4,6-13C3)1,3,5-triazine-2,4,6-tri(15N3)amine |
| InChIKey | JDSHMPZPIAZGSV-IDEBNGHGSA-N |
| SMILES | [13C]1(=N[13C](=N[13C](=N1)[15NH2])[15NH2])[15NH2] |
Computed by PubChem (NCBI)