CAS 287476-11-3 appears in our catalog under these names: Melamine-15N3, Melamine-15N3, >95% (HPLC), Melamine–15N3, MELAMINE-(TRIAMINE-15N3), 1,3,5-Triazine-2,4,6-tri(amine-15N), 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: on request, 10mg, 1mg, 5mg, 5 mg, 10 mg, 1 mg, 1x10mg.
1,3,5-triazine-2,4,6-tri(15N3)amine (CAS 287476-11-3) is a chemical compound with the molecular formula C3H6N6 and a molecular weight of 129.10 g/mol. IUPAC name: 1,3,5-triazine-2,4,6-tri(15N3)amine. InChIKey: JDSHMPZPIAZGSV-VMGGCIAMSA-N.
| Molecular formula | C3H6N6 |
|---|---|
| Molecular weight | 129.10 g/mol |
| IUPAC name | 1,3,5-triazine-2,4,6-tri(15N3)amine |
| InChIKey | JDSHMPZPIAZGSV-VMGGCIAMSA-N |
| SMILES | C1(=NC(=NC(=N1)[15NH2])[15NH2])[15NH2] |
Computed by PubChem (NCBI)