CAS 1246816-48-7 appears in our catalog under these names: N’-Methyl-4-nitrophenylene-1,2-diamine-d3, >95% (HPLC), N1-(Methyl-d3)-4-nitrobenzene-1,2-diamine. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 500mg, 50mg, 100 mg, 25 mg, 50 mg, 500 mg.
4-nitro-1-N-(trideuteriomethyl)benzene-1,2-diamine (CAS 1246816-48-7) is a chemical compound with the molecular formula C7H9N3O2 and a molecular weight of 170.18 g/mol. IUPAC name: 4-nitro-1-N-(trideuteriomethyl)benzene-1,2-diamine. InChIKey: MNIKERWISBANET-FIBGUPNXSA-N.
| Molecular formula | C7H9N3O2 |
|---|---|
| Molecular weight | 170.18 g/mol |
| IUPAC name | 4-nitro-1-N-(trideuteriomethyl)benzene-1,2-diamine |
| InChIKey | MNIKERWISBANET-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=C(C=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)