CAS 1246816-52-3 is the registry number for O-Benzyl Psilocin-d4. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 50mg, 25 mg, 2.5 mg.
1,1,2,2-tetradeuterio-N,N-dimethyl-2-(4-phenylmethoxy-1H-indol-3-yl)ethanamine (CAS 1246816-52-3) is a chemical compound with the molecular formula C19H22N2O and a molecular weight of 298.4 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-N,N-dimethyl-2-(4-phenylmethoxy-1H-indol-3-yl)ethanamine. InChIKey: LHERKDDDEMCCCU-AREBVXNXSA-N.
| Molecular formula | C19H22N2O |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-N,N-dimethyl-2-(4-phenylmethoxy-1H-indol-3-yl)ethanamine |
| InChIKey | LHERKDDDEMCCCU-AREBVXNXSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C(=CC=C2)OCC3=CC=CC=C3)C([2H])([2H])N(C)C |
Computed by PubChem (NCBI)