CAS 1246816-80-7 is the registry number for 5,6-Diamino-2-thiouracil-13C,15N. Offered by: TRC. Available pack sizes: 100mg, 10mg.
6-amino-5-(15N)azanyl-2-sulfanylidene-(613C)1H-pyrimidin-4-one (CAS 1246816-80-7) is a chemical compound with the molecular formula C4H6N4OS and a molecular weight of 160.17 g/mol. IUPAC name: 6-amino-5-(15N)azanyl-2-sulfanylidene-(613C)1H-pyrimidin-4-one. InChIKey: QYSWOQHLIDKEOL-BFQMUAMKSA-N.
| Molecular formula | C4H6N4OS |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 6-amino-5-(15N)azanyl-2-sulfanylidene-(613C)1H-pyrimidin-4-one |
| InChIKey | QYSWOQHLIDKEOL-BFQMUAMKSA-N |
| SMILES | C1(=[13C](NC(=S)NC1=O)N)[15NH2] |
Computed by PubChem (NCBI)