Products 1346601-57-7
CAS 1346601-57-7 is the registry number for 5,6-Diamino-4-thiouracil-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
5,6-diamino-4-sulfanylidene-(4,5-13C2)1H-pyrimidin-2-one (CAS 1346601-57-7) is a chemical compound with the molecular formula C4H6N4OS and a molecular weight of 160.17 g/mol. IUPAC name: 5,6-diamino-4-sulfanylidene-(4,5-13C2)1H-pyrimidin-2-one. InChIKey: GXWCTUJSEWZPNM-ZKDXJZICSA-N.
| Molecular formula | C4H6N4OS |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 5,6-diamino-4-sulfanylidene-(4,5-13C2)1H-pyrimidin-2-one |
| InChIKey | GXWCTUJSEWZPNM-ZKDXJZICSA-N |
| SMILES | C1(=[13C]([13C](=S)NC(=O)N1)N)N |
Computed by PubChem (NCBI)