CAS 1246818-12-1 is the registry number for Tiletamine-d5 Hydrochloride. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2-[deuterio(1,1,2,2-tetradeuterioethyl)amino]-2-thiophen-2-ylcyclohexan-1-one;hydrochloride (CAS 1246818-12-1) is a chemical compound with the molecular formula C12H18ClNOS and a molecular weight of 264.83 g/mol. IUPAC name: 2-[deuterio(1,1,2,2-tetradeuterioethyl)amino]-2-thiophen-2-ylcyclohexan-1-one;hydrochloride. InChIKey: ZUYKJZQOPXDNOK-FWRSOEPPSA-N.
| Molecular formula | C12H18ClNOS |
|---|---|
| Molecular weight | 264.83 g/mol |
| IUPAC name | 2-[deuterio(1,1,2,2-tetradeuterioethyl)amino]-2-thiophen-2-ylcyclohexan-1-one;hydrochloride |
| InChIKey | ZUYKJZQOPXDNOK-FWRSOEPPSA-N |
| SMILES | [2H]C([2H])C([2H])([2H])N([2H])C1(CCCCC1=O)C2=CC=CS2.Cl |
Computed by PubChem (NCBI)