Products 1588938-65-1
CAS 1588938-65-1 is the registry number for (R)-N-((R)-1-(2-Chlorophenyl)ethyl)-2-methylpropane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(R)-N-[(1R)-1-(2-chlorophenyl)ethyl]-2-methylpropane-2-sulfinamide (CAS 1588938-65-1) is a chemical compound with the molecular formula C12H18ClNOS and a molecular weight of 259.80 g/mol. IUPAC name: (R)-N-[(1R)-1-(2-chlorophenyl)ethyl]-2-methylpropane-2-sulfinamide. InChIKey: GIQZNBBGHYKHFC-JDNHERCYSA-N.
| Molecular formula | C12H18ClNOS |
|---|---|
| Molecular weight | 259.80 g/mol |
| IUPAC name | (R)-N-[(1R)-1-(2-chlorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
| InChIKey | GIQZNBBGHYKHFC-JDNHERCYSA-N |
| SMILES | C[C@H](C1=CC=CC=C1Cl)N[S@](=O)C(C)(C)C |
Computed by PubChem (NCBI)