CAS 1246818-80-3 appears in our catalog under these names: Ambroxol-d5, Ambroxol–d5. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 500μg, Get quote.
4-[(2-amino-3,5-dibromophenyl)methylamino]-1,2,2,6,6-pentadeuteriocyclohexan-1-ol (CAS 1246818-80-3) is a chemical compound with the molecular formula C13H18Br2N2O and a molecular weight of 383.13 g/mol. IUPAC name: 4-[(2-amino-3,5-dibromophenyl)methylamino]-1,2,2,6,6-pentadeuteriocyclohexan-1-ol. InChIKey: JBDGDEWWOUBZPM-SCGGTJNOSA-N.
| Molecular formula | C13H18Br2N2O |
|---|---|
| Molecular weight | 383.13 g/mol |
| IUPAC name | 4-[(2-amino-3,5-dibromophenyl)methylamino]-1,2,2,6,6-pentadeuteriocyclohexan-1-ol |
| InChIKey | JBDGDEWWOUBZPM-SCGGTJNOSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])O)([2H])[2H])NCC2=C(C(=CC(=C2)Br)Br)N)[2H] |
Computed by PubChem (NCBI)