CAS 18749-55-8 is the registry number for (E)-3-Hydroxydemethylbromhexine. Offered by: TRC. Available pack sizes: 100mg.
Cis-(1S,3R)-3-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol (CAS 18749-55-8) is a chemical compound with the molecular formula C13H18Br2N2O and a molecular weight of 378.10 g/mol. IUPAC name: cis-(1S,3R)-3-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol. InChIKey: ZZMWKUPIRQLVNP-MNOVXSKESA-N.
| Molecular formula | C13H18Br2N2O |
|---|---|
| Molecular weight | 378.10 g/mol |
| IUPAC name | cis-(1S,3R)-3-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol |
| InChIKey | ZZMWKUPIRQLVNP-MNOVXSKESA-N |
| SMILES | C1C[C@H](C[C@H](C1)O)NCC2=C(C(=CC(=C2)Br)Br)N |
Computed by PubChem (NCBI)