CAS 1246819-14-6 is the registry number for N-Desmethyl Perazine-d8. Offered by: TRC. Available pack sizes: 25mg.
10-[3-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)propyl]phenothiazine (CAS 1246819-14-6) is a chemical compound with the molecular formula C19H23N3S and a molecular weight of 333.5 g/mol. IUPAC name: 10-[3-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)propyl]phenothiazine. InChIKey: YWSUKAVVJWNXMP-JJYWRMRISA-N.
| Molecular formula | C19H23N3S |
|---|---|
| Molecular weight | 333.5 g/mol |
| IUPAC name | 10-[3-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)propyl]phenothiazine |
| InChIKey | YWSUKAVVJWNXMP-JJYWRMRISA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])CCCN2C3=CC=CC=C3SC4=CC=CC=C42)([2H])[2H])[2H] |
Computed by PubChem (NCBI)