Products 60285-35-0

CAS 60285-35-0 is the registry number for N-Desmethyl Perazine Dimalonic Acid Salt. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

10-(3-piperazin-1-ylpropyl)phenothiazine (CAS 60285-35-0) is a chemical compound with the molecular formula C19H23N3S and a molecular weight of 325.5 g/mol. IUPAC name: 10-(3-piperazin-1-ylpropyl)phenothiazine. InChIKey: YWSUKAVVJWNXMP-UHFFFAOYSA-N.

Identity
Molecular formulaC19H23N3S
Molecular weight325.5 g/mol
IUPAC name10-(3-piperazin-1-ylpropyl)phenothiazine
InChIKeyYWSUKAVVJWNXMP-UHFFFAOYSA-N
SMILESC1CN(CCN1)CCCN2C3=CC=CC=C3SC4=CC=CC=C42

Computed by PubChem (NCBI)