Products 1246819-23-7
CAS 1246819-23-7 appears in our catalog under these names: 4-Hydroxy Phenylbutazone-d9, 4-Hydroxyphenylbutazone-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
4-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-1,2-diphenylpyrazolidine-3,5-dione (CAS 1246819-23-7) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 333.4 g/mol. IUPAC name: 4-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-1,2-diphenylpyrazolidine-3,5-dione. InChIKey: VTEBWXHYBNAYKI-ABVHXWLASA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 4-hydroxy-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-1,2-diphenylpyrazolidine-3,5-dione |
| InChIKey | VTEBWXHYBNAYKI-ABVHXWLASA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1(C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)