Products 1246819-62-4
CAS 1246819-62-4 is the registry number for rac 4–Azido Deprenyl–d3. Offered by: GLPBio. Available pack sizes: 50mg.
1-(4-azidophenyl)-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine (CAS 1246819-62-4) is a chemical compound with the molecular formula C13H16N4 and a molecular weight of 231.31 g/mol. IUPAC name: 1-(4-azidophenyl)-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine. InChIKey: SADKAPHQXBJOKD-HPRDVNIFSA-N.
| Molecular formula | C13H16N4 |
|---|---|
| Molecular weight | 231.31 g/mol |
| IUPAC name | 1-(4-azidophenyl)-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine |
| InChIKey | SADKAPHQXBJOKD-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N(CC#C)C(C)CC1=CC=C(C=C1)N=[N+]=[N-] |
Computed by PubChem (NCBI)