CAS 220844-79-1 is the registry number for N-(4,6-Dimethylpyrimidin-2-yl)-n-methylbenzene-1,4-diamine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
4-N-(4,6-dimethylpyrimidin-2-yl)-4-N-methylbenzene-1,4-diamine (CAS 220844-79-1) is a chemical compound with the molecular formula C13H16N4 and a molecular weight of 228.29 g/mol. IUPAC name: 4-N-(4,6-dimethylpyrimidin-2-yl)-4-N-methylbenzene-1,4-diamine. InChIKey: AYLAFPRFEFNRSP-UHFFFAOYSA-N.
| Molecular formula | C13H16N4 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 4-N-(4,6-dimethylpyrimidin-2-yl)-4-N-methylbenzene-1,4-diamine |
| InChIKey | AYLAFPRFEFNRSP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N(C)C2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)