CAS 1246819-94-2 appears in our catalog under these names: Citalopram-d6 Oxalate, >95% (HPLC), Citalopram-d6 Oxalate, Citalopram-d6 (oxalate). Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 10 mg, 1 mg.
1-[3-[bis(trideuteriomethyl)amino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;oxalic acid (CAS 1246819-94-2) is a chemical compound with the molecular formula C22H23FN2O5 and a molecular weight of 420.5 g/mol. IUPAC name: 1-[3-[bis(trideuteriomethyl)amino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;oxalic acid. InChIKey: KTGRHKOEFSJQNS-TXHXQZCNSA-N.
| Molecular formula | C22H23FN2O5 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 1-[3-[bis(trideuteriomethyl)amino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;oxalic acid |
| InChIKey | KTGRHKOEFSJQNS-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F)C([2H])([2H])[2H].C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)