CAS 219861-08-2 appears in our catalog under these names: Citalopram Impurity 2((S)-Isomer), (S)-Citalopram oxalate, min. 95 %, 2 g, (S)-Citalopram oxalate, min. 95 %, 500 mg, Escitalopram oxalate, 95%, (S)-Citalopram Oxalate (Escitalopram Oxalate). Offered by: Hubei YoungXin, Roth, Combi-blocks, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2g, 500mg, 1g.
(1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;oxalic acid (CAS 219861-08-2) is a chemical compound with the molecular formula C22H23FN2O5 and a molecular weight of 414.4 g/mol. IUPAC name: (1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;oxalic acid. InChIKey: KTGRHKOEFSJQNS-BDQAORGHSA-N.
| Molecular formula | C22H23FN2O5 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | (1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;oxalic acid |
| InChIKey | KTGRHKOEFSJQNS-BDQAORGHSA-N |
| SMILES | CN(C)CCC[C@@]1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)