Products 1246820-06-3
CAS 1246820-06-3 appears in our catalog under these names: 4-Methylamino-d3 Antipyrine, >95% (HPLC), 4-Methylamino antipyrine-d3-1. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, Get quote.
1,5-dimethyl-2-phenyl-4-(trideuteriomethylamino)pyrazol-3-one (CAS 1246820-06-3) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 220.29 g/mol. IUPAC name: 1,5-dimethyl-2-phenyl-4-(trideuteriomethylamino)pyrazol-3-one. InChIKey: JILCEWWZTBBOFS-BMSJAHLVSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 1,5-dimethyl-2-phenyl-4-(trideuteriomethylamino)pyrazol-3-one |
| InChIKey | JILCEWWZTBBOFS-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])NC1=C(N(N(C1=O)C2=CC=CC=C2)C)C |
Computed by PubChem (NCBI)