CAS 1246820-08-5 is the registry number for 4-Methyl-2-nitroaniline-d6. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2,3,5-trideuterio-6-nitro-4-(trideuteriomethyl)aniline (CAS 1246820-08-5) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 158.19 g/mol. IUPAC name: 2,3,5-trideuterio-6-nitro-4-(trideuteriomethyl)aniline. InChIKey: DLURHXYXQYMPLT-RLTMCGQMSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | 2,3,5-trideuterio-6-nitro-4-(trideuteriomethyl)aniline |
| InChIKey | DLURHXYXQYMPLT-RLTMCGQMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[N+](=O)[O-])N)[2H] |
Computed by PubChem (NCBI)