Products 1246820-39-2
CAS 1246820-39-2 is the registry number for Diethyl 2-ethyl-2-acetamidomalonate-d3. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
Diethyl 2-acetamido-2-(2,2,2-trideuterioethyl)propanedioate (CAS 1246820-39-2) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 248.29 g/mol. IUPAC name: diethyl 2-acetamido-2-(2,2,2-trideuterioethyl)propanedioate. InChIKey: SXHWNHBPUWKECF-FIBGUPNXSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 248.29 g/mol |
| IUPAC name | diethyl 2-acetamido-2-(2,2,2-trideuterioethyl)propanedioate |
| InChIKey | SXHWNHBPUWKECF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(C(=O)OCC)(C(=O)OCC)NC(=O)C |
Computed by PubChem (NCBI)