Products 1246820-68-7
CAS 1246820-68-7 appears in our catalog under these names: L-(+)-2-Phenylglycine-d5, L-alpha-Phenyl-d5-glycine, 98 atom % D, min 98% Chemical Purity, L–α–Phenyl–glycine–d5, L-α-Phenyl-glycine-d5, 98.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 250mg, 25mg, 0,01g, 5mg, 1 mg, 5 mg.
(2S)-2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid (CAS 1246820-68-7) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 156.19 g/mol. IUPAC name: (2S)-2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid. InChIKey: ZGUNAGUHMKGQNY-FOXQAWPQSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 156.19 g/mol |
| IUPAC name | (2S)-2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid |
| InChIKey | ZGUNAGUHMKGQNY-FOXQAWPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])[C@@H](C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)