Products 358731-96-1
CAS 358731-96-1 appears in our catalog under these names: 2–Phenylglycine–d5, D,L-2-Phenylglycine-d5, DL-alpha-Phenyl-d5-glycine, 98 atom % D, min 98% Chemical Purity, 2-Phenylglycine-d5, 99.01%. Offered by: GLPBio, TRC, CDN, MedChemExpress. Available pack sizes: 1mg, 250mg, 25mg, 0,1g, 0,05g, 10mg, 5mg, 10 mg.
2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid (CAS 358731-96-1) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 156.19 g/mol. IUPAC name: 2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid. InChIKey: ZGUNAGUHMKGQNY-RALIUCGRSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 156.19 g/mol |
| IUPAC name | 2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid |
| InChIKey | ZGUNAGUHMKGQNY-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)