Products 1246820-89-2
CAS 1246820-89-2 appears in our catalog under these names: 2-PADQZ-d8, 2-Piperazinyl-4-amino-6,7-dimethoxyquinazoline-d8. Offered by: MedChemExpress, TRC. Available pack sizes: 2.5 mg, 25 mg, 2,5mg, 25mg.
6,7-dimethoxy-2-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)quinazolin-4-amine (CAS 1246820-89-2) is a chemical compound with the molecular formula C14H19N5O2 and a molecular weight of 297.38 g/mol. IUPAC name: 6,7-dimethoxy-2-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)quinazolin-4-amine. InChIKey: APKHJGDGWQDBGM-SQUIKQQTSA-N.
| Molecular formula | C14H19N5O2 |
|---|---|
| Molecular weight | 297.38 g/mol |
| IUPAC name | 6,7-dimethoxy-2-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)quinazolin-4-amine |
| InChIKey | APKHJGDGWQDBGM-SQUIKQQTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=NC3=CC(=C(C=C3C(=N2)N)OC)OC)([2H])[2H])[2H] |
Computed by PubChem (NCBI)