CAS 1352524-59-4 is the registry number for tert-Butyl N-{(3-(4-aminophenyl)-1H-1,2,4-triazol-5-yl)methyl}carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-[[3-(4-aminophenyl)-1H-1,2,4-triazol-5-yl]methyl]carbamate (CAS 1352524-59-4) is a chemical compound with the molecular formula C14H19N5O2 and a molecular weight of 289.33 g/mol. IUPAC name: tert-butyl N-[[3-(4-aminophenyl)-1H-1,2,4-triazol-5-yl]methyl]carbamate. InChIKey: FORWYEGJWLKRQC-UHFFFAOYSA-N.
| Molecular formula | C14H19N5O2 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | tert-butyl N-[[3-(4-aminophenyl)-1H-1,2,4-triazol-5-yl]methyl]carbamate |
| InChIKey | FORWYEGJWLKRQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC(=NN1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)